Products 14596-87-3

CAS 14596-87-3 is the registry number for 3-Thiophenecarboxylic acid, 2-methylphenyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(2-methylphenyl) thiophene-3-carboxylate (CAS 14596-87-3) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: (2-methylphenyl) thiophene-3-carboxylate. InChIKey: GPNMAQXHFRUBSY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O2S
Molecular weight218.27 g/mol
IUPAC name(2-methylphenyl) thiophene-3-carboxylate
InChIKeyGPNMAQXHFRUBSY-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1OC(=O)C2=CSC=C2

Computed by PubChem (NCBI)