CAS 1459793-02-2 appears in our catalog under these names: (3S)-2,3-Dihydrobenzo[b]furan-3-ylamine hydrochloride, 95%, (S)-2,3-Dihydrobenzofuran-3-amine hydrochloride 97%, (3S)-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 97%, 97%, (3S)-2,3-DIHYDROBENZO[B]FURAN-3-YLAMINE HYDROCHLORIDE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg, 1g.
(3S)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1459793-02-2) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (3S)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IVRJMBYBAPVRHB-OGFXRTJISA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (3S)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | IVRJMBYBAPVRHB-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=CC=CC=C2O1)N.Cl |
Computed by PubChem (NCBI)