CAS 1810074-72-6 appears in our catalog under these names: (R)-2,3-Dihydrobenzofuran-3-amine hydrochloride, 95%, (R)-2,3-Dihydrobenzofuran-3-amine hydrochloride, 98%, (R)-2,3-dihydrobenzofuran-3-amine hydrochloride, (R)-2,3-Dihydrobenzofuran-3-amine hydrochloride, 98%, 98%, (3R)-2,3-DIHYDROBENZO[B]FURAN-3-YLAMINE HCL, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,1g, 0,05g, 0,25g, 0,5g, 100mg.
(3R)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1810074-72-6) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: (3R)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IVRJMBYBAPVRHB-FJXQXJEOSA-N.
| Molecular formula | C8H10ClNO |
|---|---|
| Molecular weight | 171.62 g/mol |
| IUPAC name | (3R)-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | IVRJMBYBAPVRHB-FJXQXJEOSA-N |
| SMILES | C1[C@@H](C2=CC=CC=C2O1)N.Cl |
Computed by PubChem (NCBI)