Products 860689-81-2

CAS 860689-81-2 appears in our catalog under these names: 2,3-Dihydro-1-benzofuran-3-amine hydrochloride, 95%, 2,3-Dihydrobenzofuran-3-amine hydrochloride, 98%, 98%, 2,3-dihydro-1-benzofuran-3-amine hydrochloride, 97%, 2,3-Dihydrobenzofuran-3-amine hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 860689-81-2) is a chemical compound with the molecular formula C8H10ClNO and a molecular weight of 171.62 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IVRJMBYBAPVRHB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO
Molecular weight171.62 g/mol
IUPAC name2,3-dihydro-1-benzofuran-3-amine;hydrochloride
InChIKeyIVRJMBYBAPVRHB-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2O1)N.Cl

Computed by PubChem (NCBI)