CAS 1460-05-5 appears in our catalog under these names: (4-Nitro-phenyl)-acetaldehyde, 96%, 2-(4-Nitrophenyl)acetaldehyde 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 50mg, 100mg.
2-(4-nitrophenyl)acetaldehyde (CAS 1460-05-5) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-(4-nitrophenyl)acetaldehyde. InChIKey: NDXLKCBBPVHYSO-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-(4-nitrophenyl)acetaldehyde |
| InChIKey | NDXLKCBBPVHYSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)