CAS 146140-99-0 appears in our catalog under these names: 4-Phenylpyridin-3-amine 97%, 4-Phenylpyridin-3-amine, 97%, 97%, 3-Amino-4-phenylpyridine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-phenylpyridin-3-amine (CAS 146140-99-0) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-phenylpyridin-3-amine. InChIKey: JXWKYMYEJLKQLL-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-phenylpyridin-3-amine |
| InChIKey | JXWKYMYEJLKQLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NC=C2)N |
Computed by PubChem (NCBI)