CAS 1461654-89-6 is the registry number for Letrozole Impurity 56. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,2,4-triazol-1-ylmethyl)benzamide (CAS 1461654-89-6) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 4-(1,2,4-triazol-1-ylmethyl)benzamide. InChIKey: DQNCIZBMLMLIBA-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-ylmethyl)benzamide |
| InChIKey | DQNCIZBMLMLIBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)C(=O)N |
Computed by PubChem (NCBI)