CAS 1461706-98-8 appears in our catalog under these names: 5-(Aminomethyl)-n,n-dimethylpyrimidin-2-amine dihydrochloride, 95%, 5-(Aminomethyl)-N,N-dimethylpyrimidin-2-amine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
5-(aminomethyl)-N,N-dimethylpyrimidin-2-amine;dihydrochloride (CAS 1461706-98-8) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 5-(aminomethyl)-N,N-dimethylpyrimidin-2-amine;dihydrochloride. InChIKey: UCOJRMUXINJKOS-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 5-(aminomethyl)-N,N-dimethylpyrimidin-2-amine;dihydrochloride |
| InChIKey | UCOJRMUXINJKOS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)