CAS 1609403-06-6 is the registry number for 3-Methyl-5-(2-pyrrolidinyl)-1h-1,2,4-triazole dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-methyl-3-pyrrolidin-2-yl-1H-1,2,4-triazole;dihydrochloride (CAS 1609403-06-6) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 5-methyl-3-pyrrolidin-2-yl-1H-1,2,4-triazole;dihydrochloride. InChIKey: RYDDRPFBMHLWCU-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 5-methyl-3-pyrrolidin-2-yl-1H-1,2,4-triazole;dihydrochloride |
| InChIKey | RYDDRPFBMHLWCU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)