Products 1820651-25-9
CAS 1820651-25-9 is the registry number for N-(azetidin-3-yl)-1-methyl-1H-pyrazol-4-amine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 1g, 5g.
N-(azetidin-3-yl)-1-methylpyrazol-4-amine;dihydrochloride (CAS 1820651-25-9) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: N-(azetidin-3-yl)-1-methylpyrazol-4-amine;dihydrochloride. InChIKey: SLVUGOWZTZQQDO-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | N-(azetidin-3-yl)-1-methylpyrazol-4-amine;dihydrochloride |
| InChIKey | SLVUGOWZTZQQDO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)NC2CNC2.Cl.Cl |
Computed by PubChem (NCBI)