CAS 2173638-18-9 appears in our catalog under these names: 5-methyl-3-[(2r)-pyrrolidin-2-yl]-1h-1,2,4-triazole dihydrochloride, 95%, (R)-5-Methyl-3-(pyrrolidin-2-yl)-1H-1,2,4-triazole dihydrochloride, 98%, 5-Methyl-3-((2R)-pyrrolidin-2-yl)-1H-1,2,4-triazole dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-methyl-3-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride (CAS 2173638-18-9) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 5-methyl-3-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride. InChIKey: RYDDRPFBMHLWCU-QYCVXMPOSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 5-methyl-3-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride |
| InChIKey | RYDDRPFBMHLWCU-QYCVXMPOSA-N |
| SMILES | CC1=NC(=NN1)[C@H]2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)