CAS 1461707-42-5 appears in our catalog under these names: 2-Methyl-1-(5-nitro-1,2,3,4-tetrahydroisoquinolin-2-yl)propan-2-ol, 95%, 2-Methyl-1-(5-nitro-1,2,3,4-tetrahydroisoquinolin-2-yl)propan-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-1-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol (CAS 1461707-42-5) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: 2-methyl-1-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol. InChIKey: NKGVPUQGPQZUBB-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 2-methyl-1-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)propan-2-ol |
| InChIKey | NKGVPUQGPQZUBB-UHFFFAOYSA-N |
| SMILES | CC(C)(CN1CCC2=C(C1)C=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)