CAS 146257-38-7 is the registry number for Fasudil Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylquinoline-8-sulfonic acid (CAS 146257-38-7) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-methylquinoline-8-sulfonic acid. InChIKey: ZSBMDUMZTUVHRL-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-methylquinoline-8-sulfonic acid |
| InChIKey | ZSBMDUMZTUVHRL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2S(=O)(=O)O)C=C1 |
Computed by PubChem (NCBI)