CAS 146447-10-1 appears in our catalog under these names: 4-Chloro-2-fluoro-5-methoxybenzoic acid, 95%, 4-Chloro-2-fluoro-5-methoxybenzoic acid 95% (HPLC), 4-Chloro-2-fluoro-5-methoxybenzoic acid, 95% (HPLC), 95% (HPLC), 4-Chloro-2-fluoro-5-methoxybenzoic acid, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
4-chloro-2-fluoro-5-methoxybenzoic acid (CAS 146447-10-1) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 4-chloro-2-fluoro-5-methoxybenzoic acid. InChIKey: IZERBWIXHDUMBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-methoxybenzoic acid |
| InChIKey | IZERBWIXHDUMBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)F)Cl |
Computed by PubChem (NCBI)