Products 1781848-13-2
CAS 1781848-13-2 appears in our catalog under these names: 3-Chloro-6-fluoro-2-methoxybenzoic acid, 95%, 3-Chloro-6-fluoro-2-methoxybenzoic acid, 97%, 3-Chloro-6-fluoro-2-methoxybenzoic acid, ≥97.1%, 3-Chloro-6-fluoro-2-methoxybenzoic Acid, >95% (HPLC). Offered by: Combi-blocks, AmBeed, Chemat, TRC. Available pack sizes: 25g, 10g, 100g, 5g, 1g, 100mg, 500mg, 50mg.
3-chloro-6-fluoro-2-methoxybenzoic acid (CAS 1781848-13-2) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 3-chloro-6-fluoro-2-methoxybenzoic acid. InChIKey: KWAPPUIDYSPKMR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 3-chloro-6-fluoro-2-methoxybenzoic acid |
| InChIKey | KWAPPUIDYSPKMR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)Cl |
Computed by PubChem (NCBI)