Products 211172-72-4
CAS 211172-72-4 appears in our catalog under these names: 5-Chloro-2-fluoro-4-methoxybenzoic acid, 5-Chloro-2-fluoro-4-methoxybenzoic acid, 95%, 5-Chloro-2-fluoro-4-methoxybenzoic acid, 97%, 5-Chloro-2-fluoro-4-methoxybenzoic acid, 95%, 95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg.
5-chloro-2-fluoro-4-methoxybenzoic acid (CAS 211172-72-4) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 5-chloro-2-fluoro-4-methoxybenzoic acid. InChIKey: IWQHHHJUOHVVOM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 5-chloro-2-fluoro-4-methoxybenzoic acid |
| InChIKey | IWQHHHJUOHVVOM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C(=O)O)Cl |
Computed by PubChem (NCBI)