Products 886499-40-7
CAS 886499-40-7 appears in our catalog under these names: 2-Chloro-6-fluoro-3-methoxybenzoic acid, 97%, 2–Chloro–6–Fluoro–3–Methoxybenzoic Acid, 2-Chloro-6-fluoro-3-methoxybenzoic acid 98%, 2-Chloro-6-fluoro-3-methoxybenzoic acid, 98%, 98%, 2-Chloro-6-fluoro-3-methoxybenzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
2-chloro-6-fluoro-3-methoxybenzoic acid (CAS 886499-40-7) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 2-chloro-6-fluoro-3-methoxybenzoic acid. InChIKey: UXTMPKFTDKMFOF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-methoxybenzoic acid |
| InChIKey | UXTMPKFTDKMFOF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C(=O)O)Cl |
Computed by PubChem (NCBI)