Products 1464937-85-6
CAS 1464937-85-6 is the registry number for 6,7,9-Trichloro-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7,9-trichloro-2,3,4,5-tetrahydro-1,4-benzoxazepine (CAS 1464937-85-6) is a chemical compound with the molecular formula C9H8Cl3NO and a molecular weight of 252.5 g/mol. IUPAC name: 6,7,9-trichloro-2,3,4,5-tetrahydro-1,4-benzoxazepine. InChIKey: GVNSRHUTMNBVKB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl3NO |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 6,7,9-trichloro-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| InChIKey | GVNSRHUTMNBVKB-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)