Products 2703752-70-7
CAS 2703752-70-7 appears in our catalog under these names: (4,6-Dichlorobenzofuran-3-yl)methanamine hydrochloride 97%, (4,6-Dichlorobenzofuran-3-yl)methanamine hydrochloride, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4,6-dichloro-1-benzofuran-3-yl)methanamine;hydrochloride (CAS 2703752-70-7) is a chemical compound with the molecular formula C9H8Cl3NO and a molecular weight of 252.5 g/mol. IUPAC name: (4,6-dichloro-1-benzofuran-3-yl)methanamine;hydrochloride. InChIKey: LEOUTFBPPKEOLV-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl3NO |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | (4,6-dichloro-1-benzofuran-3-yl)methanamine;hydrochloride |
| InChIKey | LEOUTFBPPKEOLV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC=C2CN)Cl)Cl.Cl |
Computed by PubChem (NCBI)