CAS 346724-13-8 is the registry number for 3-Chloro-n-(2,4-dichlorophenyl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(2,4-dichlorophenyl)propanamide (CAS 346724-13-8) is a chemical compound with the molecular formula C9H8Cl3NO and a molecular weight of 252.5 g/mol. IUPAC name: 3-chloro-N-(2,4-dichlorophenyl)propanamide. InChIKey: VFMXHMBRGBXZRJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl3NO |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 3-chloro-N-(2,4-dichlorophenyl)propanamide |
| InChIKey | VFMXHMBRGBXZRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=O)CCCl |
Computed by PubChem (NCBI)