CAS 25251-76-7 appears in our catalog under these names: 2-Chloro-n-(3,4-dichlorophenyl)propanamide, 95%, 2-Chloro-N-(3,4-dichlorophenyl)propanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 5000mg.
2-chloro-N-(3,4-dichlorophenyl)propanamide (CAS 25251-76-7) is a chemical compound with the molecular formula C9H8Cl3NO and a molecular weight of 252.5 g/mol. IUPAC name: 2-chloro-N-(3,4-dichlorophenyl)propanamide. InChIKey: DAFPFECFVGRHLA-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl3NO |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 2-chloro-N-(3,4-dichlorophenyl)propanamide |
| InChIKey | DAFPFECFVGRHLA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=C(C=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)