Products 1466-83-7
CAS 1466-83-7 appears in our catalog under these names: N–Benzoyl–L–leucine, N-Benzoyl-L-leucine 98%, N-Benzoyl-L-leucine, 98%, 98%, N-Benzoyl-L-leucine, 99.61%, N-Benzoyl-L-leucine, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25mg, 50mg, 100mg, 250mg, 5 g, 50 mg.
(2S)-2-benzamido-4-methylpentanoic acid (CAS 1466-83-7) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: (2S)-2-benzamido-4-methylpentanoic acid. InChIKey: POLGZPYHEPOBFG-NSHDSACASA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | (2S)-2-benzamido-4-methylpentanoic acid |
| InChIKey | POLGZPYHEPOBFG-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)