Products 17966-67-5
CAS 17966-67-5 appears in our catalog under these names: Benzoyl-DL-leucine, 97%, Benzoyl-DL-leucine, >99.0%(HPLC)(T), Benzoyl-DL-leucine, 2-Benzamido-4-methylpentanoic acid, 98%+(HPLC),RG, N-Benzoyl-DL-leucine, 99%. Offered by: Combi-blocks, TCI, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 10g, Get quote, 500g.
2-benzamido-4-methylpentanoic acid (CAS 17966-67-5) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 2-benzamido-4-methylpentanoic acid. InChIKey: POLGZPYHEPOBFG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-benzamido-4-methylpentanoic acid |
| InChIKey | POLGZPYHEPOBFG-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)