CAS 1466429-22-0 appears in our catalog under these names: (S)-6-Bromo-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (R)-6-Bromo-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (R)–6–Bromo–2,3–dihydro–1H–inden–1–amine hydrochloride, (S)-6-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, (R)-6-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg.
(1R)-6-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1466429-22-0) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (1R)-6-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NWABIAMMAHTFCD-SBSPUUFOSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (1R)-6-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NWABIAMMAHTFCD-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)