CAS 597563-15-0 appears in our catalog under these names: 1-(3-Bromophenyl)cyclopropan-1-amine hydrochloride, 97%, 1-(3-Bromophenyl)cyclopropan-1-amine hydrochloride, 1-(3-Bromophenyl)cyclopropanamine hydrochloride 98%, 1-(3-Bromophenyl)cyclopropanamine hydrochloride, 98%, 98%, 1-(3-Bromophenyl)cyclopropan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(3-bromophenyl)cyclopropan-1-amine;hydrochloride (CAS 597563-15-0) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(3-bromophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: UWXABAPQDJQLKC-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UWXABAPQDJQLKC-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)