CAS 1159976-87-0 appears in our catalog under these names: 4-Bromo-2-chloro-n,n-dimethyl-benzenemethanamine, 95%, 1-(4-Bromo-2-chlorophenyl)-N,N-dimethylmethanamine 97%, 1-(4-Bromo-2-chlorophenyl)-N,N-dimethylmethanamine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine (CAS 1159976-87-0) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine. InChIKey: JLWNFCWRKLVYQT-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine |
| InChIKey | JLWNFCWRKLVYQT-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)