Products 146728-81-6
CAS 146728-81-6 is the registry number for rac-(1R,5S,6R,7S)-4-Oxo-3,10-dioxatricyclo(5.2.1.0,1,5)decane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,5R,6S,7R)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid (CAS 146728-81-6) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: (1S,5R,6S,7R)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid. InChIKey: ZTNJBIVXMUDZMQ-NDDNGWRZSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | (1S,5R,6S,7R)-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| InChIKey | ZTNJBIVXMUDZMQ-NDDNGWRZSA-N |
| SMILES | C1C[C@@]23COC(=O)[C@@H]2[C@@H]([C@@H]1O3)C(=O)O |
Computed by PubChem (NCBI)