Products 1467463-07-5

CAS 1467463-07-5 is the registry number for 2-(4-Ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1467463-07-5) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: 2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: OKKIOWQOTCYRRS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13FO3
Molecular weight224.23 g/mol
IUPAC name2-(4-ethoxy-3-fluorophenyl)cyclopropane-1-carboxylic acid
InChIKeyOKKIOWQOTCYRRS-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)C2CC2C(=O)O)F

Computed by PubChem (NCBI)