Products 16006-65-8
CAS 16006-65-8 is the registry number for 6-Methyl-9-(β-D-xylofuranosyl)purine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol (CAS 16006-65-8) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol. InChIKey: FIGBCBGMUIGJBD-DYUFWOLASA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
| InChIKey | FIGBCBGMUIGJBD-DYUFWOLASA-N |
| SMILES | CC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)