CAS 146794-70-9 appears in our catalog under these names: Cephalexin Impurity E (Cefradine EP Impurity G), Cefalexin EP Impurity E,Cefadroxil EP Impurity H,Cefradine EP Impurity G, Cefradine EP Impurity G, Cefadroxil Impurity 1（Cefadroxil EP Impurity H）, Cefalexin Impurity 5（EP Impurity E）. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(6R,7R)-7-(2,2-dimethylpropanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 146794-70-9) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: (6R,7R)-7-(2,2-dimethylpropanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: JLNXDMISSHNIAD-GMSGAONNSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | (6R,7R)-7-(2,2-dimethylpropanoylamino)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | JLNXDMISSHNIAD-GMSGAONNSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)C(C)(C)C)SC1)C(=O)O |
Computed by PubChem (NCBI)