Products 1468434-90-3
CAS 1468434-90-3 is the registry number for 1-(4-Amino-2-bromophenyl)pyrrolidin-2-one, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g.
1-(4-amino-2-bromophenyl)pyrrolidin-2-one (CAS 1468434-90-3) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(4-amino-2-bromophenyl)pyrrolidin-2-one. InChIKey: LGDAFKKDPJNJOQ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(4-amino-2-bromophenyl)pyrrolidin-2-one |
| InChIKey | LGDAFKKDPJNJOQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)