CAS 146844-02-2 appears in our catalog under these names: (R)–Dibenzyl 2–aminopentanedioate hydrochloride, (R)-Dibenzyl 2-aminopentanedioate hydrochloride, 97%, (R)-Dibenzyl 2-aminopentanedioate hydrochloride, 97%, 97%, H-D-Glu(OBzl)-OBzl·HCl 97%. Offered by: GLPBio, Fluorochem, Chemat, Ambeed. Available pack sizes: 100g, 25g, 250g, 500g, 5g, 10g, 1g, 50g.
Dibenzyl (2R)-2-aminopentanedioate;hydrochloride (CAS 146844-02-2) is a chemical compound with the molecular formula C19H22ClNO4 and a molecular weight of 363.8 g/mol. IUPAC name: dibenzyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: GRGJVECUQLAEDM-UNTBIKODSA-N.
| Molecular formula | C19H22ClNO4 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | dibenzyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | GRGJVECUQLAEDM-UNTBIKODSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@H](C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)