Products 34148-67-9

CAS 34148-67-9 is the registry number for Amlodipine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 34148-67-9) is a chemical compound with the molecular formula C19H22ClNO4 and a molecular weight of 363.8 g/mol. IUPAC name: diethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: HQAADEKEJNBOLM-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22ClNO4
Molecular weight363.8 g/mol
IUPAC namediethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
InChIKeyHQAADEKEJNBOLM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OCC)C)C

Computed by PubChem (NCBI)