Products 90730-96-4
CAS 90730-96-4 appears in our catalog under these names: BRL–37344, BRL-37344, 99.45%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg.
2-[4-[(2S)-2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid (CAS 90730-96-4) is a chemical compound with the molecular formula C19H22ClNO4 and a molecular weight of 363.8 g/mol. IUPAC name: 2-[4-[(2S)-2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid. InChIKey: ZGGNJJJYUVRADP-SCLBCKFNSA-N.
| Molecular formula | C19H22ClNO4 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | 2-[4-[(2S)-2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid |
| InChIKey | ZGGNJJJYUVRADP-SCLBCKFNSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)OCC(=O)O)NC[C@H](C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
Brl-37344, orb2564345