CAS 4561-10-8 appears in our catalog under these names: H–Glu(OBzl)–OBzl·HCl, L-Glutamic acid dibenzyl ester hydrochloride, 98% , Dibenzyl L-Glutamate Hydrochloride, >98.0%(HPLC)(T), H-Glu(OBzl)-OBzl·HCl 98%, Dibenzyl L-Glutamate Hydrochloride, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 1g, 5g, 25g, 500g, 1000g, 1kg, 100 g.
Dibenzyl (2S)-2-aminopentanedioate;hydrochloride (CAS 4561-10-8) is a chemical compound with the molecular formula C19H22ClNO4 and a molecular weight of 363.8 g/mol. IUPAC name: dibenzyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: GRGJVECUQLAEDM-LMOVPXPDSA-N.
| Molecular formula | C19H22ClNO4 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | dibenzyl (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | GRGJVECUQLAEDM-LMOVPXPDSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)