CAS 1469-95-0 appears in our catalog under these names: 1-Phenylhexane-1,3,5-trione, 95%, 95%, 1-Phenylhexane-1,3,5-trione 95%, 1–Phenylhexane–1,3,5–trione, 3-hydroxy-1-phenylhex-3-ene-1,5-dione, 95%. Offered by: Chemat, Ambeed, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-phenylhexane-1,3,5-trione (CAS 1469-95-0) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 1-phenylhexane-1,3,5-trione. InChIKey: PWYYHTLZMQHPLP-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-phenylhexane-1,3,5-trione |
| InChIKey | PWYYHTLZMQHPLP-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)