CAS 147006-47-1 appears in our catalog under these names: 5-Bromoquinazolin-4-ol 95%, 5-Bromo-4(3H)-quinazolinone, 95%, 95%, 5-Bromoquinazolin-4-ol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-bromo-3H-quinazolin-4-one (CAS 147006-47-1) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-3H-quinazolin-4-one. InChIKey: QGHJLGZHULRQAJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-3H-quinazolin-4-one |
| InChIKey | QGHJLGZHULRQAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)NC=N2 |
Computed by PubChem (NCBI)