CAS 14703-82-3 is the registry number for N-(3-Methoxy-4-nitrophenyl)-n,n-dimethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-methoxy-N,N-dimethyl-4-nitroaniline (CAS 14703-82-3) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3-methoxy-N,N-dimethyl-4-nitroaniline. InChIKey: SJPYRQAJLGWUSP-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-methoxy-N,N-dimethyl-4-nitroaniline |
| InChIKey | SJPYRQAJLGWUSP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)