Products 147078-60-2

CAS 147078-60-2 is the registry number for 2-Hydroxy-4-p-tolyl-nicotinic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2g.

Structural formula: {0} (CAS {1})

Methyl 4-(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxylate (CAS 147078-60-2) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 4-(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxylate. InChIKey: STYZUCBZLSWMTP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO3
Molecular weight243.26 g/mol
IUPAC namemethyl 4-(4-methylphenyl)-2-oxo-1H-pyridine-3-carboxylate
InChIKeySTYZUCBZLSWMTP-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(C(=O)NC=C2)C(=O)OC

Computed by PubChem (NCBI)