Products 54278-73-8
CAS 54278-73-8 is the registry number for Bassianin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100μg, 500μg, 1mg, 100 μg, 500 μg.
3-[(2E,4E,6E)-6,8-dimethyldeca-2,4,6-trienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2-one (CAS 54278-73-8) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: 3-[(2E,4E,6E)-6,8-dimethyldeca-2,4,6-trienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2-one. InChIKey: LJUJZTYMRBJWDZ-ZDNNFFFZSA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 3-[(2E,4E,6E)-6,8-dimethyldeca-2,4,6-trienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2-one |
| InChIKey | LJUJZTYMRBJWDZ-ZDNNFFFZSA-N |
| SMILES | CCC(C)/C=C(\C)/C=C/C=C/C(=O)C1=C(C(=CN(C1=O)O)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Bassianin, orb2299249