CAS 147396-07-4 is the registry number for (E)-1-(Benzo(b)thiophen-2-yl)ethanone Oxime. Offered by: TRC. Available pack sizes: 250mg.
(NE)-N-[1-(1-benzothiophen-2-yl)ethylidene]hydroxylamine (CAS 147396-07-4) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: (NE)-N-[1-(1-benzothiophen-2-yl)ethylidene]hydroxylamine. InChIKey: LYNWDHNMGAKITE-YRNVUSSQSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (NE)-N-[1-(1-benzothiophen-2-yl)ethylidene]hydroxylamine |
| InChIKey | LYNWDHNMGAKITE-YRNVUSSQSA-N |
| SMILES | C/C(=N\O)/C1=CC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)