CAS 54208-72-9 appears in our catalog under these names: Salbutamol Impurity 62, Salbutamol Impurity 23, α-(((1,1-Dimethylethyl)amino)methyl)-2,2-dimethyl-4H-1,3-benzodioxin-6-methanol (Salbutamol Acetonide), Salbutamol Acetonide. Offered by: Chemat Brand, Mikromol, TRC, Biosynth. Available pack sizes: on request, 25mg, 500mg, 50mg, 100mg, 250mg.
2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol (CAS 54208-72-9) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 279.37 g/mol. IUPAC name: 2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol. InChIKey: FNNNRZNBSYVOCP-UHFFFAOYSA-N.
| Molecular formula | C16H25NO3 |
|---|---|
| Molecular weight | 279.37 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol |
| InChIKey | FNNNRZNBSYVOCP-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(CNC(C)(C)C)O)C |
Computed by PubChem (NCBI)