Products 1478313-74-4
CAS 1478313-74-4 is the registry number for Ethyl 4-((3,5-dichlorophenyl)amino)-3,5-thiazolecarboxylate. Offered by: Biosynth. Available pack sizes: 25g, 10g.
Ethyl 2-(3,5-dichloroanilino)-1,3-thiazole-4-carboxylate (CAS 1478313-74-4) is a chemical compound with the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.2 g/mol. IUPAC name: ethyl 2-(3,5-dichloroanilino)-1,3-thiazole-4-carboxylate. InChIKey: RHFCTOYJTXUSCI-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | ethyl 2-(3,5-dichloroanilino)-1,3-thiazole-4-carboxylate |
| InChIKey | RHFCTOYJTXUSCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)