CAS 147849-76-1 is the registry number for 6-(2-Nitrophenyl)-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(2-nitrophenyl)-1H-pyridazin-6-one (CAS 147849-76-1) is a chemical compound with the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. IUPAC name: 3-(2-nitrophenyl)-1H-pyridazin-6-one. InChIKey: PPOOKRDNXQWOFM-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O3 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 3-(2-nitrophenyl)-1H-pyridazin-6-one |
| InChIKey | PPOOKRDNXQWOFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=O)C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)