CAS 54558-01-9 appears in our catalog under these names: 6-(3-Nitrophenyl)-2,3-dihydropyridazin-3-one, 95%, 6-(3-Nitrophenyl)pyridazin-3(2H)-one, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(3-nitrophenyl)-1H-pyridazin-6-one (CAS 54558-01-9) is a chemical compound with the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. IUPAC name: 3-(3-nitrophenyl)-1H-pyridazin-6-one. InChIKey: AFTJTAIZFQQYIN-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O3 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1H-pyridazin-6-one |
| InChIKey | AFTJTAIZFQQYIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NNC(=O)C=C2 |
Computed by PubChem (NCBI)