Products 26033-23-8
CAS 26033-23-8 appears in our catalog under these names: 3-(4-Nitrophenyl)-1h-pyrazole-4-carbaldehyde, 95%, 3-(4-Nitrophenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
5-(4-nitrophenyl)-1H-pyrazole-4-carbaldehyde (CAS 26033-23-8) is a chemical compound with the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. IUPAC name: 5-(4-nitrophenyl)-1H-pyrazole-4-carbaldehyde. InChIKey: RSIXQGMNFIJUOU-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O3 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1H-pyrazole-4-carbaldehyde |
| InChIKey | RSIXQGMNFIJUOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)