CAS 1481613-19-7 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro(3.4)octane-2-carboxylate hydrochloride, 96%, 2-Boc-2,6-Diazaspiro(3.4)octane HCl. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 10g.
Tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate;hydrochloride (CAS 1481613-19-7) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate;hydrochloride. InChIKey: SOWIWXWBCDDZID-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate;hydrochloride |
| InChIKey | SOWIWXWBCDDZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCNC2.Cl |
Computed by PubChem (NCBI)