CAS 1482921-62-9 appears in our catalog under these names: 1-(6,7-Difluoro-1-benzofuran-2-yl)ethan-1-one, 95%, 1-(6,7-Difluoro-1-benzofuran-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(6,7-difluoro-1-benzofuran-2-yl)ethanone (CAS 1482921-62-9) is a chemical compound with the molecular formula C10H6F2O2 and a molecular weight of 196.15 g/mol. IUPAC name: 1-(6,7-difluoro-1-benzofuran-2-yl)ethanone. InChIKey: IERHPXKAVQYYAN-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O2 |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 1-(6,7-difluoro-1-benzofuran-2-yl)ethanone |
| InChIKey | IERHPXKAVQYYAN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(O1)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)