Products 2158504-79-9
CAS 2158504-79-9 is the registry number for 3-(4-(Difluoromethyl)phenyl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(difluoromethyl)phenyl]prop-2-ynoic acid (CAS 2158504-79-9) is a chemical compound with the molecular formula C10H6F2O2 and a molecular weight of 196.15 g/mol. IUPAC name: 3-[4-(difluoromethyl)phenyl]prop-2-ynoic acid. InChIKey: SLIFOEGTTLIQTF-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O2 |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 3-[4-(difluoromethyl)phenyl]prop-2-ynoic acid |
| InChIKey | SLIFOEGTTLIQTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC(=O)O)C(F)F |
Computed by PubChem (NCBI)