Products 340772-56-7

CAS 340772-56-7 is the registry number for Methyl 3-(2,4-difluorophenyl)prop-2-ynoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(2,4-difluorophenyl)prop-2-ynoate (CAS 340772-56-7) is a chemical compound with the molecular formula C10H6F2O2 and a molecular weight of 196.15 g/mol. IUPAC name: methyl 3-(2,4-difluorophenyl)prop-2-ynoate. InChIKey: RYJSKWHIMZFCIK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F2O2
Molecular weight196.15 g/mol
IUPAC namemethyl 3-(2,4-difluorophenyl)prop-2-ynoate
InChIKeyRYJSKWHIMZFCIK-UHFFFAOYSA-N
SMILESCOC(=O)C#CC1=C(C=C(C=C1)F)F

Computed by PubChem (NCBI)